|
CAS#: 42261-16-5 Product: Estradiol-2,3-o-Quinone No suppilers available for the product. |
| Name | Estradiol-2,3-o-Quinone |
|---|---|
| Synonyms | (8R,9S,13S,14S,17S)-17-Hydroxy-13-Methyl-6,7,8,9,11,12,14,15,16,17-Decahydrocyclopenta[A]Phenanthrene-2,3-Quinone; Estradiol-2,3-Quinone; Ecs |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 |
| CAS Registry Number | 42261-16-5 |
| SMILES | [C@@H]23C1=CC(C(C=C1CC[C@H]2[C@H]4[C@](CC3)([C@H](CC4)O)C)=O)=O |
| InChI | 1S/C18H22O3/c1-18-7-6-11-12(14(18)4-5-17(18)21)3-2-10-8-15(19)16(20)9-13(10)11/h8-9,11-12,14,17,21H,2-7H2,1H3/t11-,12+,14-,17-,18-/m0/s1 |
| InChIKey | LBSRSXWOMYPVBY-XSSYPUMDSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.427°C at 760 mmHg (Cal.) |
| Flash point | 260.273°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Estradiol-2,3-o-Quinone |