|
CAS#: 42279-29-8 Product: Pentachlorodiphenyloxide No suppilers available for the product. |
| Name | Pentachlorodiphenyloxide |
|---|---|
| Synonyms | Benzene, 1,2,3,4,5-Pentachloro-6-Phenoxy-; 1,2,3,4,5-Pentachloro-6-Phenoxybenzene; Ether, Pentachlorophenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H5Cl5O |
| Molecular Weight | 342.44 |
| CAS Registry Number | 42279-29-8 |
| SMILES | C2=C(OC1=C(Cl)C(=C(Cl)C(=C1Cl)Cl)Cl)C=CC=C2 |
| InChI | 1S/C12H5Cl5O/c13-7-8(14)10(16)12(11(17)9(7)15)18-6-4-2-1-3-5-6/h1-5H |
| InChIKey | JDWOFUWJURZFFF-UHFFFAOYSA-N |
| Density | 1.558g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.153°C at 760 mmHg (Cal.) |
| Flash point | 129.346°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentachlorodiphenyloxide |