| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Name | 3-Ethyl-5-Methoxy-2-Methylbenzothiazolium p-Toluenesulphonate |
|---|---|
| Synonyms | 3-Ethyl-5-Methoxy-2-Methylbenzothiazolium P-Toluenesulfonate; 3-Ethyl-5-Methoxy-2-Methylbenzothiazolium P-Toluenesulphonate; Benzothiazolium, 3-Ethyl-5-Methoxy-2-Methyl-, Salt With 4-Methylbenzenesulfonic Acid (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C18H21NO4S2 |
| Molecular Weight | 379.49 |
| CAS Registry Number | 42379-68-0 |
| EINECS | 255-788-0 |
| SMILES | C2=C1[N+](=C(SC1=CC=C2OC)C)CC.C3=C([S]([O-])(=O)=O)C=CC(=C3)C |
| InChI | 1S/C11H14NOS.C7H8O3S/c1-4-12-8(2)14-11-6-5-9(13-3)7-10(11)12;1-6-2-4-7(5-3-6)11(8,9)10/h5-7H,4H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | RAPZVIBWDBUCCW-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-5-Methoxy-2-Methylbenzothiazolium p-Toluenesulphonate |