|
CAS#: 42528-99-4 Product: 4-(2-Acetoxyacetyl)Phenyl Acetate No suppilers available for the product. |
| Name | 4-(2-Acetoxyacetyl)Phenyl Acetate |
|---|---|
| Synonyms | [2-(4-Acetoxyphenyl)-2-Oxo-Ethyl] Acetate; Acetic Acid [2-(4-Acetoxyphenyl)-2-Oxoethyl] Ester; Acetic Acid [2-(4-Acetoxyphenyl)-2-Keto-Ethyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 |
| CAS Registry Number | 42528-99-4 |
| EINECS | 255-870-6 |
| SMILES | C1=C(C(=O)COC(=O)C)C=CC(=C1)OC(=O)C |
| InChI | 1S/C12H12O5/c1-8(13)16-7-12(15)10-3-5-11(6-4-10)17-9(2)14/h3-6H,7H2,1-2H3 |
| InChIKey | UYGKCTFMRDCXJL-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 365°C at 760 mmHg (Cal.) |
| Flash point | 162.274°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-Acetoxyacetyl)Phenyl Acetate |