|
CAS#: 42585-08-0 Product: Isophos 3 No suppilers available for the product. |
| Name | Isophos 3 |
|---|---|
| Synonyms | 4-Chloro-5-(Chloromethyl-Sec-Butyl-Phosphinothioyl)Oxy-2-Methyl-Aniline; 4-Chloro-5-(Chloromethyl-Sec-Butylphosphinothioyl)Oxy-2-Methylaniline; [4-Chloro-5-(Chloromethyl-Sec-Butyl-Thiophosphoryl)Oxy-2-Methyl-Phenyl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18Cl2NOPS |
| Molecular Weight | 326.22 |
| CAS Registry Number | 42585-08-0 |
| SMILES | C1=C(C(=CC(=C1C)N)O[P](C(CC)C)(=S)CCl)Cl |
| InChI | 1S/C12H18Cl2NOPS/c1-4-9(3)17(18,7-13)16-12-6-11(15)8(2)5-10(12)14/h5-6,9H,4,7,15H2,1-3H3 |
| InChIKey | NNDMGAZBSIMXQD-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.24°C at 760 mmHg (Cal.) |
| Flash point | 212.792°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isophos 3 |