| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Zinc Isopropylxanthate |
|---|---|
| Synonyms | Zinc Isopropoxymethanedithioate; Zinc O,O'-Diisopropyl Bis(Dithiocarbonate); Zinc, Bis(O-(1-Methylethyl) Carbonodithioato-Kappas,Kappas')-, (T-4)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14O2S4Zn |
| Molecular Weight | 335.82 |
| CAS Registry Number | 42590-53-4 |
| SMILES | CC(OC([S-])=S)C.CC(OC([S-])=S)C.[Zn++] |
| InChI | 1S/2C4H8OS2.Zn/c2*1-3(2)5-4(6)7;/h2*3H,1-2H3,(H,6,7);/q;;+2/p-2 |
| InChIKey | SZNCKQHFYDCMLZ-UHFFFAOYSA-L |
| Boiling point | 138°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 37.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Zinc Isopropylxanthate |