| Chemodex Ltd. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 244-4825 | |||
![]() |
info@chemodex.com | |||
| Chemical distributor | ||||
| Crescent Chemical Co. Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Classification | Analytical chemistry >> Standard >> Pesticides, veterinary drugs and fertilizers |
|---|---|
| Name | Methyldymron |
| Synonyms | 1-Methyl-3-(1-Methyl-1-Phenyl-Ethyl)-1-Phenyl-Urea; 1-Methyl-3-(1-Methyl-1-Phenylethyl)-1-Phenylurea; 1-(Alpha,Alpha-Dimethylbenzyl)-3-Methyl-3-Phenylurea |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 |
| CAS Registry Number | 42609-73-4 |
| SMILES | C1=CC=CC=C1N(C(NC(C2=CC=CC=C2)(C)C)=O)C |
| InChI | 1S/C17H20N2O/c1-17(2,14-10-6-4-7-11-14)18-16(20)19(3)15-12-8-5-9-13-15/h4-13H,1-3H3,(H,18,20) |
| InChIKey | FMINYZXVCTYSNY-UHFFFAOYSA-N |
| Density | 1.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.577°C at 760 mmHg (Cal.) |
| Flash point | 227.511°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyldymron |