|
CAS#: 428-13-7 Product: Difluoronitroacetic Acid Methyl Ester No suppilers available for the product. |
| Name | Difluoronitroacetic Acid Methyl Ester |
|---|---|
| Synonyms | Methyl 2,2-Difluoro-2-Nitro-Acetate; 2,2-Difluoro-2-Nitroacetic Acid Methyl Ester; 2,2-Difluoro-2-Nitro-Acetic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C3H3F2NO4 |
| Molecular Weight | 155.06 |
| CAS Registry Number | 428-13-7 |
| SMILES | COC(=O)C(F)(F)[N+]([O-])=O |
| InChI | 1S/C3H3F2NO4/c1-10-2(7)3(4,5)6(8)9/h1H3 |
| InChIKey | WTHNVDSODCAINI-UHFFFAOYSA-N |
| Density | 1.473g/cm3 (Cal.) |
|---|---|
| Boiling point | 112.437°C at 760 mmHg (Cal.) |
| Flash point | 21.801°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Difluoronitroacetic Acid Methyl Ester |