|
CAS#: 42953-11-7 Product: Ethyl N-(5-Chloro-2-Hydroxy-Phenyl)Carbamate No suppilers available for the product. |
| Name | Ethyl N-(5-Chloro-2-Hydroxy-Phenyl)Carbamate |
|---|---|
| Synonyms | Ethyl N-(5-Chloro-2-Hydroxy-Phenyl)Carbamate; N-(5-Chloro-2-Hydroxyphenyl)Carbamic Acid Ethyl Ester; N-(5-Chloro-2-Hydroxy-Phenyl)Carbamic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 |
| CAS Registry Number | 42953-11-7 |
| SMILES | C1=C(Cl)C=CC(=C1NC(OCC)=O)O |
| InChI | 1S/C9H10ClNO3/c1-2-14-9(13)11-7-5-6(10)3-4-8(7)12/h3-5,12H,2H2,1H3,(H,11,13) |
| InChIKey | KOYKJLUPGYMUHO-UHFFFAOYSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 271.045°C at 760 mmHg (Cal.) |
| Flash point | 117.724°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl N-(5-Chloro-2-Hydroxy-Phenyl)Carbamate |