|
CAS#: 42979-86-2 Product: 2,4-Dihydroxyestrone No suppilers available for the product. |
| Name | 2,4-Dihydroxyestrone |
|---|---|
| Synonyms | 2,4-Dihydroxyestrone; Estra-1,3,5(10)-Trien-17-One, 2,3,4-Trihydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 |
| CAS Registry Number | 42979-86-2 |
| SMILES | [C@H]23[C@H]1[C@@](C(=O)CC1)(CC[C@@H]2C4=C(CC3)C(=C(O)C(=C4)O)O)C |
| InChI | 1S/C18H22O4/c1-18-7-6-9-10(13(18)4-5-15(18)20)2-3-11-12(9)8-14(19)17(22)16(11)21/h8-10,13,19,21-22H,2-7H2,1H3/t9-,10+,13-,18-/m0/s1 |
| InChIKey | JHMKRVZOGMNBGV-HIONPOMWSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.502°C at 760 mmHg (Cal.) |
| Flash point | 276.63°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dihydroxyestrone |