Online Database of Chemicals from Around the World
|
CAS#: 42981-76-0 Product: 2,6-Bis(1,1-Dimethylethyl)-1,2,3,4-Tetrahydronaphthalene No suppilers available for the product. |
| Name | 2,6-Bis(1,1-Dimethylethyl)-1,2,3,4-Tetrahydronaphthalene |
|---|---|
| Synonyms | 2,6-Ditert-Butyltetralin; 2,6-Di-Tert-Butyltetralin; Naphthalene, 2,6-Bis(1,1-Dimethylethyl)-1,2,3,4-Tetrahydro- |
| Molecular Structure |  |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 |
| CAS Registry Number | 42981-76-0 |
| SMILES | C1=C(C=C2C(=C1)CC(CC2)C(C)(C)C)C(C)(C)C |
| InChI | 1S/C18H28/c1-17(2,3)15-9-7-14-12-16(18(4,5)6)10-8-13(14)11-15/h7,9,11,16H,8,10,12H2,1-6H3 |
| InChIKey | AQPAQXOKPQQUGW-UHFFFAOYSA-N |
| Density | 0.908g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.195°C at 760 mmHg (Cal.) |
| Flash point | 140.208°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Bis(1,1-Dimethylethyl)-1,2,3,4-Tetrahydronaphthalene |