|
CAS#: 42990-62-5 Product: L-2-Aminooxy-3-Phenylpropionic Acid No suppilers available for the product. |
| Name | L-2-Aminooxy-3-Phenylpropionic Acid |
|---|---|
| Synonyms | 3-(2-Aminooxyphenyl)Propionic Acid; Aopp; Benzenepropanoic Acid, Alpha-(Aminooxy)-, (S)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 |
| CAS Registry Number | 42990-62-5 |
| SMILES | C1=C(C(=CC=C1)CCC(=O)O)ON |
| InChI | 1S/C9H11NO3/c10-13-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6,10H2,(H,11,12) |
| InChIKey | CGVPQHIRIGIDLE-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.749°C at 760 mmHg (Cal.) |
| Flash point | 178.628°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-2-Aminooxy-3-Phenylpropionic Acid |