|
CAS#: 4306-32-5 Product: N-(4-Nitrophenyl)-2,2,2-Trichloroacetamide No suppilers available for the product. |
| Name | N-(4-Nitrophenyl)-2,2,2-Trichloroacetamide |
|---|---|
| Synonyms | 2,2,2-Trichloro-N-(4-Nitrophenyl)Ethanamide; Acetamide, 2,2,2-Trichloro-N-(4-Nitrophenyl)-; Nsc50927 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl3N2O3 |
| Molecular Weight | 283.50 |
| CAS Registry Number | 4306-32-5 |
| SMILES | C1=CC(=CC=C1NC(C(Cl)(Cl)Cl)=O)[N+]([O-])=O |
| InChI | 1S/C8H5Cl3N2O3/c9-8(10,11)7(14)12-5-1-3-6(4-2-5)13(15)16/h1-4H,(H,12,14) |
| InChIKey | SUAOKKUTCUPNHY-UHFFFAOYSA-N |
| Density | 1.682g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.262°C at 760 mmHg (Cal.) |
| Flash point | 205.548°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Nitrophenyl)-2,2,2-Trichloroacetamide |