CAS#: 4331-22-0 Product: Versicolorin B No suppilers available for the product. |
Name | Versicolorin B |
---|---|
Synonyms | Anthra(2,3-B)Furo(3,2-D)Furan-5,10-Dione, 2,3,3A,12A-Tetrahydro-4,6,8-Trihydroxy-, Cis-(+-)-; Versicolorin C; Anthra(2,3-B)Furo(3,2-D)Furan-5,10-Dione, 2,3,3A,12A-Tetrahydro-4,6,8-Trihydroxy-, (3As,12Ar)- |
Molecular Structure | ![]() |
Molecular Formula | C18H12O7 |
Molecular Weight | 340.29 |
CAS Registry Number | 4331-22-0 (16049-49-3) |
SMILES | [C@H]45[C@H](C3=C(C1=C(C(=O)C2=C(C1=O)C(=CC(=C2)O)O)C=C3O4)O)CCO5 |
InChI | 1S/C18H12O7/c19-6-3-8-12(10(20)4-6)16(22)14-9(15(8)21)5-11-13(17(14)23)7-1-2-24-18(7)25-11/h3-5,7,18-20,23H,1-2H2/t7-,18+/m0/s1 |
InChIKey | BABJNKGTTYCTOO-ULCDLSAGSA-N |
Density | 1.703g/cm3 (Cal.) |
---|---|
Boiling point | 604.862°C at 760 mmHg (Cal.) |
Flash point | 228.342°C (Cal.) |
Market Analysis Reports |
List of Reports Available for Versicolorin B |