|
CAS#: 4333-12-4 Product: 3-(5-Nitro-2-Furyl)-1-(4-Methoxy)Phenol-2-Propen-1-One No suppilers available for the product. |
| Name | 3-(5-Nitro-2-Furyl)-1-(4-Methoxy)Phenol-2-Propen-1-One |
|---|---|
| Synonyms | (E)-1-(4-Methoxyphenyl)-3-(3-Nitro-2-Furyl)Prop-2-En-1-One; Acrylophenone, 4'-Methoxy-3-(5-Nitro-2-Furyl)-; Brn 1290931 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 |
| CAS Registry Number | 4333-12-4 |
| SMILES | C1=COC(=C1[N+]([O-])=O)\C=C\C(=O)C2=CC=C(OC)C=C2 |
| InChI | 1S/C14H11NO5/c1-19-11-4-2-10(3-5-11)13(16)6-7-14-12(15(17)18)8-9-20-14/h2-9H,1H3/b7-6+ |
| InChIKey | SJWBPHHFYAYMKM-VOTSOKGWSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.42°C at 760 mmHg (Cal.) |
| Flash point | 226.811°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(5-Nitro-2-Furyl)-1-(4-Methoxy)Phenol-2-Propen-1-One |