|
CAS#: 4356-25-6 Product: 1'H-5Α-Cholestano[3,2-b]Indole No suppilers available for the product. |
| Name | 1'H-5Α-Cholestano[3,2-b]Indole |
|---|---|
| Synonyms | 1'H-5.Alpha.-Cholest-2-Eno[3,2-B]Indole; 1'H-Cholest-2-Eno[3,2-B]Indole, (5.Alpha.)-; Nsc61708 |
| Molecular Structure | ![]() |
| Molecular Formula | C33H49N |
| Molecular Weight | 459.76 |
| CAS Registry Number | 4356-25-6 |
| SMILES | [C@H]15[C@@H]([C@@]2([C@@H](CC1)CC3=C(C2)C4=C([NH]3)C=CC=C4)C)CC[C@]6([C@H]5CC[C@@H]6[C@@H](CCCC(C)C)C)C |
| InChI | 1S/C33H49N/c1-21(2)9-8-10-22(3)27-15-16-28-25-14-13-23-19-31-26(24-11-6-7-12-30(24)34-31)20-33(23,5)29(25)17-18-32(27,28)4/h6-7,11-12,21-23,25,27-29,34H,8-10,13-20H2,1-5H3/t22-,23+,25+,27-,28+,29+,32-,33+/m1/s1 |
| InChIKey | UJPMSSIEJPGKGY-YHPMGPRQSA-N |
| Density | 1.018g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.547°C at 760 mmHg (Cal.) |
| Flash point | 234.548°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1'H-5Α-Cholestano[3,2-b]Indole |