|
CAS#: 436-41-9 Product: Costaclavine No suppilers available for the product. |
| Name | Costaclavine |
|---|---|
| Synonyms | Costaclavin; Epicostaclavin; Costaclavine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 |
| CAS Registry Number | 436-41-9 |
| SMILES | [C@@H]14[C@@H](CC2=C[NH]C3=CC=CC1=C23)N(C[C@H](C)C4)C |
| InChI | 1S/C16H20N2/c1-10-6-13-12-4-3-5-14-16(12)11(8-17-14)7-15(13)18(2)9-10/h3-5,8,10,13,15,17H,6-7,9H2,1-2H3/t10-,13+,15-/m1/s1 |
| InChIKey | VLMZMRDOMOGGFA-RIEGTJTDSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.469°C at 760 mmHg (Cal.) |
| Flash point | 200.23°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Costaclavine |