|
CAS#: 4388-07-2 Product: 4,4'-Dimethyl-1,1'-Biphenyl-2,2',5,5'-Tetraone No suppilers available for the product. |
| Name | 4,4'-Dimethyl-1,1'-Biphenyl-2,2',5,5'-Tetraone |
|---|---|
| Synonyms | 2-Methyl-5-(4-Methyl-3,6-Dioxo-1-Cyclohexa-1,4-Dienyl)-1,4-Benzoquinone; 2-(3,6-Diketo-4-Methyl-1-Cyclohexa-1,4-Dienyl)-5-Methyl-P-Benzoquinone; 5,5'-Bi-P-Toluquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 |
| CAS Registry Number | 4388-07-2 |
| SMILES | CC1=CC(C(=CC1=O)C2=CC(=O)C(=CC2=O)C)=O |
| InChI | 1S/C14H10O4/c1-7-3-13(17)9(5-11(7)15)10-6-12(16)8(2)4-14(10)18/h3-6H,1-2H3 |
| InChIKey | UKRBOJBKGKKYFW-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.728°C at 760 mmHg (Cal.) |
| Flash point | 131.547°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Dimethyl-1,1'-Biphenyl-2,2',5,5'-Tetraone |