|
CAS#: 439-65-6 Product: 17b-Chloro-16a-Methylyohimban No suppilers available for the product. |
| Name | 17b-Chloro-16a-Methylyohimban |
|---|---|
| Synonyms | 17-Beta-Chloro-16-Alpha-Methylyohimbane; Brn 0895150 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H25ClN2 |
| Molecular Weight | 328.88 |
| CAS Registry Number | 439-65-6 |
| SMILES | [C@H]34C2=C(C1=CC=CC=C1[NH]2)CCN3C[C@H]5[C@H](C4)[C@H]([C@@H](CC5)Cl)C |
| InChI | 1S/C20H25ClN2/c1-12-16-10-19-20-15(14-4-2-3-5-18(14)22-20)8-9-23(19)11-13(16)6-7-17(12)21/h2-5,12-13,16-17,19,22H,6-11H2,1H3/t12-,13+,16-,17-,19+/m1/s1 |
| InChIKey | JOLDHPNEHLCUSL-LURSQZLSSA-N |
| Density | 1.246g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.935°C at 760 mmHg (Cal.) |
| Flash point | 254.337°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17b-Chloro-16a-Methylyohimban |