Online Database of Chemicals from Around the World
|
CAS#: 4412-09-3 Product: Mucochloric Anhydride No suppilers available for the product. |
| Name | Mucochloric Anhydride |
|---|---|
| Synonyms | 3,4-Dichloro-5-[(3,4-Dichloro-5-Keto-2H-Furan-2-Yl)Oxy]-5H-Furan-2-One; Crotonic Acid, 4,4'-Oxybis(2,3-Dichloro-4-Hydroxy-, Di-.Gamma.-Lactone; Gc 2466 |
| Molecular Structure |  |
| Molecular Formula | C8H2Cl4O5 |
| Molecular Weight | 319.91 |
| CAS Registry Number | 4412-09-3 |
| SMILES | O=C2C(=C(C(OC1C(=C(Cl)C(O1)=O)Cl)O2)Cl)Cl |
| InChI | 1S/C8H2Cl4O5/c9-1-3(11)7(15-5(1)13)17-8-4(12)2(10)6(14)16-8/h7-8H |
| InChIKey | PESQEUXEQYJQCC-UHFFFAOYSA-N |
| Density | 1.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.4±45.0°C at 760 mmHg (Cal.) |
| Flash point | 225.4±27.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mucochloric Anhydride |