|
CAS#: 4425-26-7 Product: Desthiobenzylpenicillin No suppilers available for the product. |
| Name | Desthiobenzylpenicillin |
|---|---|
| Synonyms | (2R)-3-Methyl-2-[(3S)-2-Oxo-3-[(1-Oxo-2-Phenylethyl)Amino]-1-Azetidinyl]Butanoic Acid; (2R)-2-[(3S)-2-Keto-3-[(2-Phenylacetyl)Amino]Azetidin-1-Yl]-3-Methyl-Butyric Acid; (2R)-3-Methyl-2-[(3S)-2-Oxo-3-(2-Phenylethanoylamino)Azetidin-1-Yl]Butanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 |
| CAS Registry Number | 4425-26-7 |
| SMILES | [C@@H]2(NC(=O)CC1=CC=CC=C1)C(=O)N([C@@H](C(=O)O)C(C)C)C2 |
| InChI | 1S/C16H20N2O4/c1-10(2)14(16(21)22)18-9-12(15(18)20)17-13(19)8-11-6-4-3-5-7-11/h3-7,10,12,14H,8-9H2,1-2H3,(H,17,19)(H,21,22)/t12-,14+/m0/s1 |
| InChIKey | FZGPEVZHDQGHEP-GXTWGEPZSA-N |
| Density | 1.27g/cm3 (Cal.) |
|---|---|
| Boiling point | 612.536°C at 760 mmHg (Cal.) |
| Flash point | 324.25°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Desthiobenzylpenicillin |