|
CAS#: 4431-47-4 Product: Isowogonin No suppilers available for the product. |
| Name | Isowogonin |
|---|---|
| Synonyms | 5,8-Dihydroxy-7-Methoxy-2-Phenyl-Chromen-4-One; 5,8-Dihydroxy-7-Methoxy-2-Phenyl-4-Chromenone; 5,8-Dihydroxy-7-Methoxy-2-Phenyl-Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 |
| CAS Registry Number | 4431-47-4 |
| SMILES | C1=C(C(=C2C(=C1O)C(=O)C=C(O2)C3=CC=CC=C3)O)OC |
| InChI | 1S/C16H12O5/c1-20-13-8-11(18)14-10(17)7-12(21-16(14)15(13)19)9-5-3-2-4-6-9/h2-8,18-19H,1H3 |
| InChIKey | CGTZOVPQCMHAIE-UHFFFAOYSA-N |
| Density | 1.42g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.979°C at 760 mmHg (Cal.) |
| Flash point | 208.67°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isowogonin |