| Name | Dihydroanisoin |
|---|---|
| Synonyms | 1,2-Ethanediol, 1,2-Bis(4-Methoxyphenyl)-; Dihydroanisoin |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 |
| CAS Registry Number | 4464-76-0 |
| SMILES | C2=C(C(C(C1=CC=C(OC)C=C1)O)O)C=CC(=C2)OC |
| InChI | 1S/C16H18O4/c1-19-13-7-3-11(4-8-13)15(17)16(18)12-5-9-14(20-2)10-6-12/h3-10,15-18H,1-2H3 |
| InChIKey | RKRWHUXXTPLPAL-UHFFFAOYSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.794°C at 760 mmHg (Cal.) |
| Flash point | 230.061°C (Cal.) |
| (1) | Marta Bettoni, Tiziana Del Giacco, Fausto Elisei, Cesare Rol and Giovanni V. Sebastiani. Evidences in favour of a single electron transfer (SET) mechanism in the TiO sensitized photo-oxidation of α-hydroxy- and α,β-dihydroxybenzyl derivatives in water, Phys. Chem. Chem. Phys., 2010, 12, 5425. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dihydroanisoin |