|
CAS#: 4560-58-1 Product: 3-beta-Hydroxy-12-Oxo-5-beta-Cholanoic acid No suppilers available for the product. |
| Name | 3-beta-Hydroxy-12-Oxo-5-beta-Cholanoic acid |
|---|---|
| Synonyms | 4-(3-Hydroxy-12-Keto-10,13-Dimethyl-1,2,3,4,5,6,7,8,9,11,14,15,16,17-Tetradecahydrocyclopenta[A]Phenanthren-17-Yl)Valeric Acid; Nsc224319; 12-Keto-Lithocholic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 |
| CAS Registry Number | 4560-58-1 |
| SMILES | C(C(C4C3(C(C2C(C1(C(CC(O)CC1)CC2)C)CC3=O)CC4)C)C)CC(O)=O |
| InChI | 1S/C24H38O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-20,25H,4-13H2,1-3H3,(H,27,28) |
| InChIKey | CVNYHSDFZXHMMJ-UHFFFAOYSA-N |
| Density | 1.124g/cm3 (Cal.) |
|---|---|
| Boiling point | 545.885°C at 760 mmHg (Cal.) |
| Flash point | 298.005°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-beta-Hydroxy-12-Oxo-5-beta-Cholanoic acid |