|
CAS#: 460-99-1 Product: 2-Chloro-1,1,2-Trifluoro-1-(Trichloromethoxy)Ethane No suppilers available for the product. |
| Name | 2-Chloro-1,1,2-Trifluoro-1-(Trichloromethoxy)Ethane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C3HCl4F3O |
| Molecular Weight | 251.85 |
| CAS Registry Number | 460-99-1 |
| EINECS | 207-308-6 |
| SMILES | O(C(Cl)(Cl)Cl)C(F)(F)C(Cl)F |
| InChI | 1S/C3HCl4F3O/c4-1(8)2(9,10)11-3(5,6)7/h1H |
| InChIKey | LSAUFTHJJZPNMH-UHFFFAOYSA-N |
| Density | 1.716g/cm3 (Cal.) |
|---|---|
| Boiling point | 171.097°C at 760 mmHg (Cal.) |
| Flash point | 57.278°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-1,1,2-Trifluoro-1-(Trichloromethoxy)Ethane |