Online Database of Chemicals from Around the World
|
CAS#: 4612-63-9 Product: 2,3-Dimethyl-9H-Fluorene No suppilers available for the product. |
| Name | 2,3-Dimethyl-9H-Fluorene |
|---|---|
| Synonyms | 9H-Fluorene, 2,3-Dimethyl-; Fluorene, 2,3-Dimethyl-; 2,3-Dimethylfluorene |
| Molecular Structure |  |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 |
| CAS Registry Number | 4612-63-9 |
| SMILES | C1=C(C)C(=CC2=C1C3=C(C2)C=CC=C3)C |
| InChI | 1S/C15H14/c1-10-7-13-9-12-5-3-4-6-14(12)15(13)8-11(10)2/h3-8H,9H2,1-2H3 |
| InChIKey | WZKBKKCKPZMGHV-UHFFFAOYSA-N |
| Density | 1.074g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.234°C at 760 mmHg (Cal.) |
| Flash point | 162.226°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethyl-9H-Fluorene |