|
CAS#: 46492-07-3 Product: Disodium Anthracene-9,10-Diolate No suppilers available for the product. |
| Name | Disodium Anthracene-9,10-Diolate |
|---|---|
| Synonyms | 9,10-Anthracenediol, Disodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8Na2O2 |
| Molecular Weight | 254.20 |
| CAS Registry Number | 46492-07-3 |
| SMILES | C1=CC=CC2=C1C(=C3C(=C2[O-])C=CC=C3)[O-].[Na+].[Na+] |
| InChI | 1S/C14H10O2.2Na/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;;/h1-8,15-16H;;/q;2*+1/p-2 |
| InChIKey | RMEKRPRYWRUTKH-UHFFFAOYSA-L |
| Boiling point | 475°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 240.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Disodium Anthracene-9,10-Diolate |