|
CAS#: 4657-47-0 Product: (2E,4E)-3-Methyl-5-[2-Methyl-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)Phenyl]-2,4-Pentadienoic Acid No suppilers available for the product. |
| Name | (2E,4E)-3-Methyl-5-[2-Methyl-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)Phenyl]-2,4-Pentadienoic Acid |
|---|---|
| Synonyms | 3-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 |
| CAS Registry Number | 4657-47-0 |
| SMILES | CC1=C(C(CCC1)(C)C)C2=CC(=C(C=C2)/C=C/C(=C/C(=O)O)/C)C |
| InChI | 1S/C22H28O2/c1-15(13-20(23)24)8-9-18-10-11-19(14-17(18)3)21-16(2)7-6-12-22(21,4)5/h8-11,13-14H,6-7,12H2,1-5H3,(H,23,24)/b9-8+,15-13+ |
| InChIKey | AQWSEIKMQSDKCG-XWMBBDDHSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.1±44.0°C at 760 mmHg (Cal.) |
| Flash point | 365.9±19.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2E,4E)-3-Methyl-5-[2-Methyl-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)Phenyl]-2,4-Pentadienoic Acid |