|
CAS#: 466-73-9 Product: Hemanthidine No suppilers available for the product. |
| Name | Hemanthidine |
|---|---|
| Synonyms | Haemanthidine; Hemanthidine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 |
| CAS Registry Number | 466-73-9 |
| SMILES | [C@]135[C@@H](N(C[C@H]1O)C(O)C4=CC2=C(OCO2)C=C34)C[C@H](OC)C=C5 |
| InChI | 1S/C17H19NO5/c1-21-9-2-3-17-11-6-13-12(22-8-23-13)5-10(11)16(20)18(7-15(17)19)14(17)4-9/h2-3,5-6,9,14-16,19-20H,4,7-8H2,1H3/t9-,14+,15-,16?,17+/m1/s1 |
| InChIKey | ZSTPNQLNQBRLQF-DHQLAWRFSA-N |
| Density | 1.512g/cm3 (Cal.) |
|---|---|
| Boiling point | 517.306°C at 760 mmHg (Cal.) |
| Flash point | 266.658°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hemanthidine |