|
CAS#: 469-02-3 Product: Humulon No suppilers available for the product. |
| Name | Humulon |
|---|---|
| Synonyms | 5,6-Dihydroxy-2,6-Bis(3-Methylbut-2-Enyl)-4-(3-Methyl-1-Oxobutyl)Cyclohex-4-Ene-1,3-Dione; 5,6-Dihydroxy-4-Isovaleryl-2,6-Bis(3-Methylbut-2-Enyl)Cyclohex-4-Ene-1,3-Quinone; 2,4-Cyclohexadien-1-One, 3,5,6-Trihydroxy-2,6-Bis(3-Methyl-2-Butenyl)-4-(3-Methyl-1-Oxobutyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 |
| CAS Registry Number | 469-02-3 |
| SMILES | C(C1(C(=C(C(C(C1=O)CC=C(C)C)=O)C(CC(C)C)=O)O)O)C=C(C)C |
| InChI | 1S/C21H30O5/c1-12(2)7-8-15-18(23)17(16(22)11-14(5)6)20(25)21(26,19(15)24)10-9-13(3)4/h7,9,14-15,25-26H,8,10-11H2,1-6H3 |
| InChIKey | IEHWDPKFDXJDJL-UHFFFAOYSA-N |
| Density | 1.121g/cm3 (Cal.) |
|---|---|
| Boiling point | 514.351°C at 760 mmHg (Cal.) |
| Flash point | 278.955°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Humulon |