|
CAS#: 4750-56-5 Product: 1-Methyl-5-Nitro-2-(2-Phenylethenyl)Imidazole No suppilers available for the product. |
| Name | 1-Methyl-5-Nitro-2-(2-Phenylethenyl)Imidazole |
|---|---|
| Synonyms | 1-Methyl-5-Nitro-2-(2-Phenylethenyl)Imidazole; 1-Methyl-5-Nitro-2-(2-Phenylvinyl)Imidazole; 1-Methyl-5-Nitro-2-[(E)-2-Phenylvinyl]Imidazole |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 |
| CAS Registry Number | 4750-56-5 |
| SMILES | C1=C([N+](=O)[O-])[N](C(=N1)\C=C\C2=CC=CC=C2)C |
| InChI | 1S/C12H11N3O2/c1-14-11(13-9-12(14)15(16)17)8-7-10-5-3-2-4-6-10/h2-9H,1H3/b8-7+ |
| InChIKey | HGBWQGJWYQJSEA-BQYQJAHWSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.842°C at 760 mmHg (Cal.) |
| Flash point | 224.647°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-5-Nitro-2-(2-Phenylethenyl)Imidazole |