Online Database of Chemicals from Around the World
|
CAS#: 475-26-3 Product: 1,1'-(2,2,2-Trichloroethylidene)Bis(4-Fluorobenzene) No suppilers available for the product. |
| Name | 1,1'-(2,2,2-Trichloroethylidene)Bis(4-Fluorobenzene) |
|---|---|
| Synonyms | Difluorodiphenyltrichloroethane; Aids-166931; Aids166931 |
| Molecular Structure |  |
| Molecular Formula | C14H9Cl3F2 |
| Molecular Weight | 321.58 |
| CAS Registry Number | 475-26-3 |
| EINECS | 207-493-3 |
| SMILES | C1=CC(=CC=C1F)C(C2=CC=C(C=C2)F)C(Cl)(Cl)Cl |
| InChI | 1S/C14H9Cl3F2/c15-14(16,17)13(9-1-5-11(18)6-2-9)10-3-7-12(19)8-4-10/h1-8,13H |
| InChIKey | CLSXNIPAOWPLFR-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.6±37.0°C at 760 mmHg (Cal.) |
| Flash point | 199.4±19.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(2,2,2-Trichloroethylidene)Bis(4-Fluorobenzene) |