|
CAS#: 47553-71-9 Product: N-[(1-[1,1'-Biphenyl]-4-Yl-1-Methylethoxy)Carbonyl]-L-Isoleucine No suppilers available for the product. |
| Name | N-[(1-[1,1'-Biphenyl]-4-Yl-1-Methylethoxy)Carbonyl]-L-Isoleucine |
|---|---|
| Synonyms | (2S,3S)-3-Methyl-2-[[1-Methyl-1-(4-Phenylphenyl)Ethoxy]Carbonylamino]Pentanoic Acid; (2S,3S)-3-Methyl-2-[[[1-Methyl-1-(4-Phenylphenyl)Ethoxy]-Oxomethyl]Amino]Pentanoic Acid; (2S,3S)-3-Methyl-2-[[1-Methyl-1-(4-Phenylphenyl)Ethoxy]Carbonylamino]Valeric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 |
| CAS Registry Number | 47553-71-9 |
| EINECS | 256-320-8 |
| SMILES | [C@@H](NC(OC(C1=CC=C(C=C1)C2=CC=CC=C2)(C)C)=O)(C(=O)O)[C@H](CC)C |
| InChI | 1S/C22H27NO4/c1-5-15(2)19(20(24)25)23-21(26)27-22(3,4)18-13-11-17(12-14-18)16-9-7-6-8-10-16/h6-15,19H,5H2,1-4H3,(H,23,26)(H,24,25)/t15-,19-/m0/s1 |
| InChIKey | MKKCVNJPERCQBR-KXBFYZLASA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 542.697°C at 760 mmHg (Cal.) |
| Flash point | 282.013°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(1-[1,1'-Biphenyl]-4-Yl-1-Methylethoxy)Carbonyl]-L-Isoleucine |