|
CAS#: 476-27-7 Product: 5,7,8-Trimethoxy-9-Methylfuro[2,3-b]Quinolin-4(9H)-One No suppilers available for the product. |
| Name | 5,7,8-Trimethoxy-9-Methylfuro[2,3-b]Quinolin-4(9H)-One |
|---|---|
| Synonyms | 5,7,8-Trimethoxy-9-Methyl-Furo[2,3-B]Quinolin-4-One; 5,7,8-Trimethoxy-9-Methyl-4-Furo[2,3-B]Quinolinone; Nsc103011 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 |
| CAS Registry Number | 476-27-7 |
| SMILES | C2=C(C(=C1N(C)C3=C(C(C1=C2OC)=O)C=CO3)OC)OC |
| InChI | 1S/C15H15NO5/c1-16-12-11(13(17)8-5-6-21-15(8)16)9(18-2)7-10(19-3)14(12)20-4/h5-7H,1-4H3 |
| InChIKey | JDSSUKRVTPIYBN-UHFFFAOYSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.954°C at 760 mmHg (Cal.) |
| Flash point | 236.206°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7,8-Trimethoxy-9-Methylfuro[2,3-b]Quinolin-4(9H)-One |