Online Database of Chemicals from Around the World
|
CAS#: 4766-40-9 Product: 6,7-Cyclopentanochrysene No suppilers available for the product. |
| Name | 6,7-Cyclopentanochrysene |
|---|---|
| Synonyms | 6,7-Cypcr; Cyclopenta(Hi)Chrysene, 4,5-Dihydro- |
| Molecular Structure |  |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 |
| CAS Registry Number | 4766-40-9 |
| SMILES | C1=C4C(=CC=C1)C3=CC5=C2C(=CC=CC2=C3C=C4)CC5 |
| InChI | 1S/C20H14/c1-2-6-16-13(4-1)10-11-17-18-7-3-5-14-8-9-15(20(14)18)12-19(16)17/h1-7,10-12H,8-9H2 |
| InChIKey | HTPWHRSKXRPGQE-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.971°C at 760 mmHg (Cal.) |
| Flash point | 245.294°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Cyclopentanochrysene |