|
CAS#: 477-12-3 Product: Caranine No suppilers available for the product. |
| Name | Caranine |
|---|---|
| Synonyms | 9,10-Methylenedioxygalanth-3(12)-En-1Alpha-Ol; Chebi:3383; C08521 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 |
| CAS Registry Number | 477-12-3 |
| SMILES | [C@@H]34C2=CC1=C(OCO1)C=C2CN5CCC(=CC[C@H]3O)[C@H]45 |
| InChI | 1S/C16H17NO3/c18-12-2-1-9-3-4-17-7-10-5-13-14(20-8-19-13)6-11(10)15(12)16(9)17/h1,5-6,12,15-16,18H,2-4,7-8H2/t12-,15-,16-/m1/s1 |
| InChIKey | XKYSLILSDJBMCU-DAXOMENPSA-N |
| Density | 1.436g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.556°C at 760 mmHg (Cal.) |
| Flash point | 224.474°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Caranine |