Online Database of Chemicals from Around the World
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononyl Ester; 2-Methylacrylic Acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononyl Ester |
| Molecular Structure |  |
| Molecular Formula | C13H7F17O2 |
| Molecular Weight | 518.17 |
| CAS Registry Number | 48077-33-4 |
| EINECS | 256-353-8 |
| SMILES | C(OC(=O)C(=C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C13H7F17O2/c1-4(2)5(31)32-3-6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h1,3H2,2H3 |
| InChIKey | ZDXYSIRXXGOEEA-UHFFFAOYSA-N |
| Density | 1.549g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.125°C at 760 mmHg (Cal.) |
| Flash point | 93.928°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononyl Methacrylate |
