|
CAS#: 483-26-1 Product: Alloyohimban No suppilers available for the product. |
| Name | Alloyohimban |
|---|---|
| Synonyms | Alloyohimbane; Nsc127746 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 |
| CAS Registry Number | 483-26-1 |
| SMILES | C1=CC=CC2=C1C3=C([NH]2)C4N(CC3)CC5C(C4)CCCC5 |
| InChI | 1S/C19H24N2/c1-2-6-14-12-21-10-9-16-15-7-3-4-8-17(15)20-19(16)18(21)11-13(14)5-1/h3-4,7-8,13-14,18,20H,1-2,5-6,9-12H2 |
| InChIKey | JUPDIHMJFPDGMY-UHFFFAOYSA-N |
| Density | 1.192g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.129°C at 760 mmHg (Cal.) |
| Flash point | 228.45°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Alloyohimban |