|
CAS#: 483-49-8 Product: Tetrahydroprotoberberine No suppilers available for the product. |
| Name | Tetrahydroprotoberberine |
|---|---|
| Synonyms | 5,8,13,13A-Tetrahydro-6H-Dibenzo[A,G]Quinolizine; 6H-Dibenzo(A,G)Quinolizine, 5,8,13,13A-Tetrahydro-; Berbine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 |
| CAS Registry Number | 483-49-8 |
| SMILES | C1=CC4=C(C=C1)CN3CCC2=C(C=CC=C2)C3C4 |
| InChI | 1S/C17H17N/c1-2-7-15-12-18-10-9-13-5-3-4-8-16(13)17(18)11-14(15)6-1/h1-8,17H,9-12H2 |
| InChIKey | BRLDZKPJJNASGG-UHFFFAOYSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.162°C at 760 mmHg (Cal.) |
| Flash point | 151.788°C (Cal.) |
| (1) | Qiaoxia Liu, Shiyi Qiu, Hui Yu, Yanxiong Ke, Yu Jin and Xinmiao Liang. Selective separation of structure-related alkaloids in Rhizoma coptidis with “click” binaphthyl stationary phase and their structural elucidation with liquid chromatography-mass spectrometry, Analyst, 2011, 136, 4357. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Tetrahydroprotoberberine |