|
CAS#: 4837-79-0 Product: Alstovenine No suppilers available for the product. |
| Name | Alstovenine |
|---|---|
| Synonyms | 3-Isovenenatine; Isovenenatine |
| Molecular Structure | ![]() |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.47 |
| CAS Registry Number | 4837-79-0 |
| SMILES | [C@H]34C1=C(C2=C([NH]1)C=CC=C2OC)CCN3C[C@@H]5[C@H](C4)[C@H](C(=O)OC)[C@@H](CC5)O |
| InChI | 1S/C22H28N2O4/c1-27-18-5-3-4-15-19(18)13-8-9-24-11-12-6-7-17(25)20(22(26)28-2)14(12)10-16(24)21(13)23-15/h3-5,12,14,16-17,20,23,25H,6-11H2,1-2H3/t12-,14+,16+,17-,20+/m1/s1 |
| InChIKey | WMMZYEBFJWWUJX-IFBQROQASA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 571.283°C at 760 mmHg (Cal.) |
| Flash point | 299.301°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Alstovenine |