| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1-(7-Hydroxy-5-Methoxy-2,2-Dimethyl-2H-Chromen-8-Yl)Ethanone |
|---|---|
| Synonyms | 1-(7-Hydroxy-5-Methoxy-2,2-Dimethyl-Chromen-8-Yl)Ethanone; 1-(7-Hydroxy-5-Methoxy-2,2-Dimethyl-8-Chromenyl)Ethanone; Nsc14135 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 |
| CAS Registry Number | 484-18-4 |
| SMILES | C2=C(O)C(=C1OC(C=CC1=C2OC)(C)C)C(=O)C |
| InChI | 1S/C14H16O4/c1-8(15)12-10(16)7-11(17-4)9-5-6-14(2,3)18-13(9)12/h5-7,16H,1-4H3 |
| InChIKey | LTDSNAYFLFUPPT-UHFFFAOYSA-N |
| Density | 1.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.746°C at 760 mmHg (Cal.) |
| Flash point | 161.02°C (Cal.) |
| (1) | Cardillo G., Cricchio R., Merlini L.. Synthesis of d,l-cannabichromene, franklinone and other natural chromenes☆, Tetrahedron, 1968 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(7-Hydroxy-5-Methoxy-2,2-Dimethyl-2H-Chromen-8-Yl)Ethanone |