|
CAS#: 487-61-6 Product: 4-(1H-Inden-1-Ylidenemethyl)Benzen-1-Amine No suppilers available for the product. |
| Name | 4-(1H-Inden-1-Ylidenemethyl)Benzen-1-Amine |
|---|---|
| Synonyms | 4-(1-Indenylidenemethyl)Aniline; [4-(Inden-1-Ylidenemethyl)Phenyl]Amine; 4-(1H-Inden-1-Ylidenemethyl)Aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 |
| CAS Registry Number | 487-61-6 |
| SMILES | C1=CC=CC3=C1\C(=C\C2=CC=C(N)C=C2)C=C3 |
| InChI | 1S/C16H13N/c17-15-9-5-12(6-10-15)11-14-8-7-13-3-1-2-4-16(13)14/h1-11H,17H2/b14-11+ |
| InChIKey | GISMNWZLKDONAA-SDNWHVSQSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.905°C at 760 mmHg (Cal.) |
| Flash point | 223.283°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1H-Inden-1-Ylidenemethyl)Benzen-1-Amine |