|
CAS#: 489-85-0 Product: 1,4-Dimethyl-7-Isopropenylazulene No suppilers available for the product. |
| Name | 1,4-Dimethyl-7-Isopropenylazulene |
|---|---|
| Synonyms | 7-Isopropenyl-1,4-Dimethyl-Azulene; 7-Isopropenyl-1,4-Dimethylazulene; 1,4-Dimethyl-7-Prop-1-En-2-Yl-Azulene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 |
| CAS Registry Number | 489-85-0 |
| SMILES | CC1=CC=C2C1=CC(=CC=C2C)C(=C)C |
| InChI | 1S/C15H16/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h5-9H,1H2,2-4H3 |
| InChIKey | KFLXZUPIDNPCSD-UHFFFAOYSA-N |
| Density | 0.972g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.388°C at 760 mmHg (Cal.) |
| Flash point | 153.828°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dimethyl-7-Isopropenylazulene |