|
CAS#: 4919-51-1 Product: 1,1',1''-(1-Cyclopropene-1,2,3-triyl)tribenzene No suppilers available for the product. |
| Name | 1,1',1''-(1-Cyclopropene-1,2,3-triyl)tribenzene |
|---|---|
| Synonyms | Nsc122605; St5446985; Triphenylcyclopropenylium, Bromide |
| Molecular Structure | ![]() |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 |
| CAS Registry Number | 4919-51-1 (16510-49-9) |
| SMILES | C4=C(C1C(=C1C2=CC=CC=C2)C3=CC=CC=C3)C=CC=C4 |
| InChI | 1S/C21H16/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)21(19)18-14-8-3-9-15-18/h1-15,19H |
| InChIKey | UFTDGVXRVMJEDI-UHFFFAOYSA-N |
| Density | 1.142g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.413°C at 760 mmHg (Cal.) |
| Flash point | 165.922°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1',1''-(1-Cyclopropene-1,2,3-triyl)tribenzene |