| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 8-Methoxy-1,4-Naphthoquinone |
|---|---|
| Synonyms | 5-Methoxy-1,4-Naphthoquinone; Zinc00261797; 1,4-Naphthalenedione, 5-Methoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.18 |
| CAS Registry Number | 4923-61-9 |
| SMILES | C1=CC=C2C(=C1OC)C(C=CC2=O)=O |
| InChI | 1S/C11H8O3/c1-14-10-4-2-3-7-8(12)5-6-9(13)11(7)10/h2-6H,1H3 |
| InChIKey | DBDLTJRCKGCKSK-UHFFFAOYSA-N |
| Density | 1.284g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.747°C at 760 mmHg (Cal.) |
| Flash point | 170.508°C (Cal.) |
| (1) | Dumitru Ghereg, Heinz Gornitzka, Henri Ranaivonjatovo and Jean Escudié. Reactions of germenes with various naphthoquinones controlled by substituent effects, Dalton Trans., 2010, 39, 2016. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 8-Methoxy-1,4-Naphthoquinone |