|
CAS#: 4935-28-8 Product: Thiophosphoric Acid O,O-Diethyl O-(Coumarin-3-Yl) Ester No suppilers available for the product. |
| Name | Thiophosphoric Acid O,O-Diethyl O-(Coumarin-3-Yl) Ester |
|---|---|
| Synonyms | 3-Diethoxyphosphinothioyloxy-2-Chromenone; 3-Diethoxythiophosphoryloxycoumarin; Ent 27,144 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15O5PS |
| Molecular Weight | 314.29 |
| CAS Registry Number | 4935-28-8 |
| SMILES | C1=CC=CC2=C1OC(C(=C2)O[P](=S)(OCC)OCC)=O |
| InChI | 1S/C13H15O5PS/c1-3-15-19(20,16-4-2)18-12-9-10-7-5-6-8-11(10)17-13(12)14/h5-9H,3-4H2,1-2H3 |
| InChIKey | LWRAXFXWIOKUAY-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.352°C at 760 mmHg (Cal.) |
| Flash point | 204.998°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiophosphoric Acid O,O-Diethyl O-(Coumarin-3-Yl) Ester |