| Name | Phosphohistidine |
|---|---|
| Synonyms | (2S)-3-(3H-Imidazol-4-Yl)-2-(Phosphonoamino)Propionic Acid; Phosphohistidine; 3-Phosphohistidine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10N3O5P |
| Molecular Weight | 235.14 |
| CAS Registry Number | 4936-08-7 |
| SMILES | [C@@H](N[P](=O)(O)O)(C(=O)O)CC1=CN=C[NH]1 |
| InChIKey | FDIKHVQUPVCJFA-YFKPBYRVSA-N |
| Density | 1.764g/cm3 (Cal.) |
|---|---|
| Boiling point | 689.026°C at 760 mmHg (Cal.) |
| Flash point | 370.51°C (Cal.) |
| (1) | Satyan Sharma and André H. Juffer. Hydrolysis of phosphohistidine in water and in prostatic acid phosphatase, Chem. Commun., 2009, 6385. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Phosphohistidine |