|
CAS#: 49561-88-8 Product: 3-Tert-Butylphenyl Chloroformate No suppilers available for the product. |
| Name | 3-Tert-Butylphenyl Chloroformate |
|---|---|
| Synonyms | Chloroformic Acid (3-Tert-Butylphenyl) Ester; (3-Tert-Butylphenyl) Chloromethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 |
| CAS Registry Number | 49561-88-8 |
| EINECS | 256-374-2 |
| SMILES | C1=C(OC(Cl)=O)C=CC=C1C(C)(C)C |
| InChI | 1S/C11H13ClO2/c1-11(2,3)8-5-4-6-9(7-8)14-10(12)13/h4-7H,1-3H3 |
| InChIKey | BYUPCPGESMKIBW-UHFFFAOYSA-N |
| Density | 1.127g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.639°C at 760 mmHg (Cal.) |
| Flash point | 90.807°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Tert-Butylphenyl Chloroformate |