|
CAS#: 497-88-1 Product: (aS,2S)-1-Methyl-alpha-Phenyl-2-Piperidineethanol No suppilers available for the product. |
| Name | (aS,2S)-1-Methyl-alpha-Phenyl-2-Piperidineethanol |
|---|---|
| Synonyms | (1S)-2-[(2S)-1-Methyl-2-Piperidyl]-1-Phenyl-Ethanol; (1S)-2-[(2S)-1-Methyl-2-Piperidinyl]-1-Phenylethanol; (1S)-2-[(2S)-1-Methylpiperidin-2-Yl]-1-Phenyl-Ethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 |
| CAS Registry Number | 497-88-1 |
| SMILES | [C@H]2(C[C@@H](C1=CC=CC=C1)O)N(C)CCCC2 |
| InChI | 1S/C14H21NO/c1-15-10-6-5-9-13(15)11-14(16)12-7-3-2-4-8-12/h2-4,7-8,13-14,16H,5-6,9-11H2,1H3/t13-,14-/m0/s1 |
| InChIKey | GOWRYACIDZSIHI-KBPBESRZSA-N |
| Density | 1.025g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.06°C at 760 mmHg (Cal.) |
| Flash point | 147.859°C (Cal.) |
| (1) | Roderick W. Bates and Jutatip Boonsombat. Synthesis of sedamine by tethered cyclofunctionalisation, Org. Biomol. Chem., 2005, 3, 520. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (aS,2S)-1-Methyl-alpha-Phenyl-2-Piperidineethanol |