|
CAS#: 49786-40-5 Product: 2,3,4,5,6,7-Hexahydro-2,4-Dioxo-3-Phenyl-1H-Cyclopentapyrimidine-1-Acetic Acid No suppilers available for the product. |
| Name | 2,3,4,5,6,7-Hexahydro-2,4-Dioxo-3-Phenyl-1H-Cyclopentapyrimidine-1-Acetic Acid |
|---|---|
| Synonyms | 2-(2,4-Diketo-3-Phenyl-6,7-Dihydro-5H-Cyclopenta[E]Pyrimidin-1-Yl)Acetic Acid; 2-(2,4-Dioxo-3-Phenyl-6,7-Dihydro-5H-Cyclopenta[E]Pyrimidin-1-Yl)Ethanoic Acid; 1-Carboxymethyl-2,4-Dioxo-3-Phenyl-1,2,3,4,6,7-Hexahydro-5H-Cyclopenta(D)Pyrimidine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 |
| CAS Registry Number | 49786-40-5 |
| SMILES | C3=C(N1C(=O)C2=C(N(C1=O)CC(=O)O)CCC2)C=CC=C3 |
| InChI | 1S/C15H14N2O4/c18-13(19)9-16-12-8-4-7-11(12)14(20)17(15(16)21)10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,18,19) |
| InChIKey | VSVGMINYEOJZMP-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.621°C at 760 mmHg (Cal.) |
| Flash point | 256.567°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,5,6,7-Hexahydro-2,4-Dioxo-3-Phenyl-1H-Cyclopentapyrimidine-1-Acetic Acid |